C19H15Cl2N3O — CID 26622306
(E)-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 26622306) has the molecular formula C19H15Cl2N3O and a molecular weight of 372.26 g/mol. Its IUPAC name is (E)-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 26622306 |
| Molecular Formula | C19H15Cl2N3O |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (E)-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)/C=C/c1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H15Cl2N3O/c1-24(12-13-6-8-15(20)16(21)10-13)19(25)9-7-14-11-22-17-4-2-3-5-18(17)23-14/h2-11H,12H2,1H3/b9-7+ |
| InChIKey | FDQNUMIMMABKIX-VQHVLOKHSA-N |
| XLogP | 4.61 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|