C23H27FN2O5S — CID 2662432
[2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate (PubChem CID 2662432) has the molecular formula C23H27FN2O5S and a molecular weight of 462.54 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2662432 |
| Molecular Formula | C23H27FN2O5S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [2-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN2O5S/c1-17(18-6-10-20(24)11-7-18)25-22(27)16-31-23(28)19-8-12-21(13-9-19)32(29,30)26-14-4-2-3-5-15-26/h6-13,17H,2-5,14-16H2,1H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | LSQJNTACDHDYLF-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |