C23H21F2N3O2S2 — CID 26635625
(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[3-(4-fluorophenyl)sulfanylpropyl]prop-2-enamide (PubChem CID 26635625) has the molecular formula C23H21F2N3O2S2 and a molecular weight of 473.57 g/mol. Its IUPAC name is (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[3-(4-fluorophenyl)sulfanylpropyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[3-(4-fluorophenyl)sulfanylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 26635625 |
| Molecular Formula | C23H21F2N3O2S2 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-[3-(4-fluorophenyl)sulfanylpropyl]prop-2-enamide |
| SMILES | CC(=O)N(c1nc(/C=C/C(=O)NCCCSc2ccc(F)cc2)cs1)c1ccccc1F |
| InChI | InChI=1S/C23H21F2N3O2S2/c1-16(29)28(21-6-3-2-5-20(21)25)23-27-18(15-32-23)9-12-22(30)26-13-4-14-31-19-10-7-17(24)8-11-19/h2-3,5-12,15H,4,13-14H2,1H3,(H,26,30)/b12-9+ |
| InChIKey | PVWCNYAKIGTOLP-FMIVXFBMSA-N |
| XLogP | 5.42 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|