C19H19N3O3 — CID 26638727
2-[4-[(2R)-4-oxo-3-prop-2-enyl-1,2-dihydroquinazolin-2-yl]phenoxy]acetamide (PubChem CID 26638727) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[4-[(2R)-4-oxo-3-prop-2-enyl-1,2-dihydroquinazolin-2-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[(2R)-4-oxo-3-prop-2-enyl-1,2-dihydroquinazolin-2-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 26638727 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-[4-[(2R)-4-oxo-3-prop-2-enyl-1,2-dihydroquinazolin-2-yl]phenoxy]acetamide |
| SMILES | C=CCN1C(=O)c2ccccc2N[C@H]1c1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-11-22-18(21-16-6-4-3-5-15(16)19(22)24)13-7-9-14(10-8-13)25-12-17(20)23/h2-10,18,21H,1,11-12H2,(H2,20,23)/t18-/m1/s1 |
| InChIKey | MWKHFHDBSJZIEE-GOSISDBHSA-N |
| XLogP | 2.30 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|