C20H23FN2O4S — CID 2664078
1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 2664078) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is 1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 2664078 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23FN2O4S/c1-2-27-18-7-9-19(10-8-18)28(25,26)23-13-11-22(12-14-23)20(24)15-16-3-5-17(21)6-4-16/h3-10H,2,11-15H2,1H3 |
| InChIKey | JBGCPJNZYSVIKL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |