C18H19BrN2O4S — CID 26641485
3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-N-prop-2-enylbenzamide (PubChem CID 26641485) has the molecular formula C18H19BrN2O4S and a molecular weight of 439.33 g/mol. Its IUPAC name is 3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-N-prop-2-enylbenzamide.
| Compound Name | 3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 26641485 |
| Molecular Formula | C18H19BrN2O4S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)Nc2ccc(OCC)c(Br)c2)c1 |
| InChI | InChI=1S/C18H19BrN2O4S/c1-3-10-20-18(22)13-6-5-7-15(11-13)26(23,24)21-14-8-9-17(25-4-2)16(19)12-14/h3,5-9,11-12,21H,1,4,10H2,2H3,(H,20,22) |
| InChIKey | PCLMGLXYUCDBBP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|