C22H27N3O4 — CID 26648081
N-(benzylcarbamoyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide (PubChem CID 26648081) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(benzylcarbamoyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 26648081 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2CC(=O)NC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-28-17-10-11-20(29-2)18(13-17)19-9-6-12-25(19)15-21(26)24-22(27)23-14-16-7-4-3-5-8-16/h3-5,7-8,10-11,13,19H,6,9,12,14-15H2,1-2H3,(H2,23,24,26,27)/t19-/m0/s1 |
| InChIKey | QSCMIKFVAKZFEL-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |