C25H26FN3O2 — CID 26649782
N-benzyl-2-[[2-[ethyl-[(3-fluorophenyl)methyl]amino]acetyl]amino]benzamide (PubChem CID 26649782) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is N-benzyl-2-[[2-[ethyl-[(3-fluorophenyl)methyl]amino]acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-[ethyl-[(3-fluorophenyl)methyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 26649782 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-benzyl-2-[[2-[ethyl-[(3-fluorophenyl)methyl]amino]acetyl]amino]benzamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(=O)NCc1ccccc1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C25H26FN3O2/c1-2-29(17-20-11-8-12-21(26)15-20)18-24(30)28-23-14-7-6-13-22(23)25(31)27-16-19-9-4-3-5-10-19/h3-15H,2,16-18H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | DSOWXLRFXMUGAL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |