C19H23NO4 — CID 2665532
N-(2-ethyl-6-methylphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 2665532) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2665532 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C19H23NO4/c1-6-13-9-7-8-12(2)18(13)20-19(21)14-10-16(23-4)17(24-5)11-15(14)22-3/h7-11H,6H2,1-5H3,(H,20,21) |
| InChIKey | IRPONWYXOWARNU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |