C20H22Cl2N2O3S — CID 26674902
1-[2-(2,5-dichlorophenyl)sulfonylethyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 26674902) has the molecular formula C20H22Cl2N2O3S and a molecular weight of 441.38 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26674902 |
| Molecular Formula | C20H22Cl2N2O3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(CCS(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H22Cl2N2O3S/c21-16-6-7-18(22)19(14-16)28(26,27)13-12-24-10-8-15(9-11-24)20(25)23-17-4-2-1-3-5-17/h1-7,14-15H,8-13H2,(H,23,25) |
| InChIKey | CEMXYAIGOYPWOT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |