About phenyl 2-(1H-indol-3-yl)acetate
phenyl 2-(1H-indol-3-yl)acetate (PubChem CID 2668417) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is phenyl 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | phenyl 2-(1H-indol-3-yl)acetate |
| PubChem CID | 2668417 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | phenyl 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)Oc1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c18-16(19-13-6-2-1-3-7-13)10-12-11-17-15-9-5-4-8-14(12)15/h1-9,11,17H,10H2 |
| InChIKey | FVQKYZNRXLBAOB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-(1H-indol-3-yl)acetate?
The IUPAC name of phenyl 2-(1H-indol-3-yl)acetate (CID 2668417) is phenyl 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for phenyl 2-(1H-indol-3-yl)acetate?
The canonical SMILES for phenyl 2-(1H-indol-3-yl)acetate is O=C(Cc1c[nH]c2ccccc12)Oc1ccccc1.
What is the InChIKey of phenyl 2-(1H-indol-3-yl)acetate?
The InChIKey is FVQKYZNRXLBAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c18-16(19-13-6-2-1-3-7-13)10-12-11-17-15-9-5-4-8-14(12)15/h1-9,11,17H,10H2.
What are the key properties of phenyl 2-(1H-indol-3-yl)acetate?
phenyl 2-(1H-indol-3-yl)acetate has a molecular weight of 251.29 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 2668417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).