About (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one
(5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 26684421) has the molecular formula C18H18N2OS
and a molecular weight of 310.42 g/mol. Its IUPAC name is (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 26684421 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C[C@H]1NC(=S)N(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H18N2OS/c1-13-17(21)20(18(22)19-13)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | YAIDQPZSPWXUSV-CYBMUJFWSA-N |
| XLogP | 2.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one (CID 26684421) is (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one is C[C@H]1NC(=S)N(CC(c2ccccc2)c2ccccc2)C1=O.
What is the InChIKey of (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one?
The InChIKey is YAIDQPZSPWXUSV-CYBMUJFWSA-N. The full InChI is InChI=1S/C18H18N2OS/c1-13-17(21)20(18(22)19-13)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3,(H,19,22)/t13-/m1/s1.
What are the key properties of (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one?
(5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one has a molecular weight of 310.42 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-(2,2-diphenylethyl)-5-methyl-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 26684421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).