C18H17FN2OS — CID 2668630
4-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]butanamide (PubChem CID 2668630) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 2668630 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[(4-fluorophenyl)methyl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2s1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN2OS/c19-14-10-8-13(9-11-14)12-20-17(22)6-3-7-18-21-15-4-1-2-5-16(15)23-18/h1-2,4-5,8-11H,3,6-7,12H2,(H,20,22) |
| InChIKey | YGXPZUAHCSTCAN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |