C24H18ClNO5 — CID 26686582
[4-[(2-chlorobenzoyl)amino]phenyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 26686582) has the molecular formula C24H18ClNO5 and a molecular weight of 435.86 g/mol. Its IUPAC name is [4-[(2-chlorobenzoyl)amino]phenyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | [4-[(2-chlorobenzoyl)amino]phenyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 26686582 |
| Molecular Formula | C24H18ClNO5 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [4-[(2-chlorobenzoyl)amino]phenyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)Oc3ccc(NC(=O)c4ccccc4Cl)cc3)coc2c1 |
| InChI | InChI=1S/C24H18ClNO5/c1-29-18-10-11-19-15(14-30-22(19)13-18)12-23(27)31-17-8-6-16(7-9-17)26-24(28)20-4-2-3-5-21(20)25/h2-11,13-14H,12H2,1H3,(H,26,28) |
| InChIKey | SPHYGWXXFBNPCY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|