C23H21N3O3S — CID 2669103
2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide (PubChem CID 2669103) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 2669103 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1Cc1ccco1)NCCc1ccccc1 |
| InChI | InChI=1S/C23H21N3O3S/c27-21(24-13-12-17-7-2-1-3-8-17)16-30-23-25-20-11-5-4-10-19(20)22(28)26(23)15-18-9-6-14-29-18/h1-11,14H,12-13,15-16H2,(H,24,27) |
| InChIKey | KZWGRBQJUORZGK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |