About [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate
[2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate (PubChem CID 26695) has the molecular formula C15H10ClI2NO3
and a molecular weight of 541.51 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate.
Molecular Properties
| Compound Name | [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate |
| PubChem CID | 26695 |
| Molecular Formula | C15H10ClI2NO3 |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 540.84 |
| IUPAC Name | [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate |
| SMILES | CC(=O)Oc1c(I)cc(I)cc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClI2NO3/c1-8(20)22-14-12(6-10(17)7-13(14)18)15(21)19-11-4-2-9(16)3-5-11/h2-7H,1H3,(H,19,21) |
| InChIKey | ICKMASVVMCGZLR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate?
The IUPAC name of [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate (CID 26695) is [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate.
What is the SMILES notation for [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate?
The canonical SMILES for [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate is CC(=O)Oc1c(I)cc(I)cc1C(=O)Nc1ccc(Cl)cc1.
What is the InChIKey of [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate?
The InChIKey is ICKMASVVMCGZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClI2NO3/c1-8(20)22-14-12(6-10(17)7-13(14)18)15(21)19-11-4-2-9(16)3-5-11/h2-7H,1H3,(H,19,21).
What are the key properties of [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate?
[2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate has a molecular weight of 541.51 g/mol, XLogP of 4.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-chlorophenyl)carbamoyl]-4,6-diiodophenyl] acetate is sourced from PubChem (CID 26695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).