C17H17FN2O2 — CID 26697243
N-[2-(4-ethylanilino)-2-oxoethyl]-4-fluorobenzamide (PubChem CID 26697243) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-[2-(4-ethylanilino)-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[2-(4-ethylanilino)-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 26697243 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[2-(4-ethylanilino)-2-oxoethyl]-4-fluorobenzamide |
| SMILES | CCc1ccc(NC(=O)CNC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H17FN2O2/c1-2-12-3-9-15(10-4-12)20-16(21)11-19-17(22)13-5-7-14(18)8-6-13/h3-10H,2,11H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | JLNXTPFXWRDHJN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |