About methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate
methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate (PubChem CID 2669729) has the molecular formula C15H13N3O3S
and a molecular weight of 315.35 g/mol. Its IUPAC name is methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate |
| PubChem CID | 2669729 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CSc2n[nH]c(-c3ccccc3)n2)o1 |
| InChI | InChI=1S/C15H13N3O3S/c1-20-14(19)12-8-7-11(21-12)9-22-15-16-13(17-18-15)10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,16,17,18) |
| InChIKey | RQIPOWXXTLOSSW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate (CID 2669729) is methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate is COC(=O)c1ccc(CSc2n[nH]c(-c3ccccc3)n2)o1.
What is the InChIKey of methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
The InChIKey is RQIPOWXXTLOSSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O3S/c1-20-14(19)12-8-7-11(21-12)9-22-15-16-13(17-18-15)10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,16,17,18).
What are the key properties of methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate?
methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate has a molecular weight of 315.35 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]furan-2-carboxylate is sourced from PubChem (CID 2669729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).