C24H20N2O5S — CID 26700219
[4-[(2-methoxybenzoyl)amino]phenyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate (PubChem CID 26700219) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is [4-[(2-methoxybenzoyl)amino]phenyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate.
| Compound Name | [4-[(2-methoxybenzoyl)amino]phenyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate |
|---|---|
| PubChem CID | 26700219 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [4-[(2-methoxybenzoyl)amino]phenyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate |
| SMILES | COc1ccccc1C(=O)Nc1ccc(OC(=O)c2ccc3c(c2)NC(=O)CCS3)cc1 |
| InChI | InChI=1S/C24H20N2O5S/c1-30-20-5-3-2-4-18(20)23(28)25-16-7-9-17(10-8-16)31-24(29)15-6-11-21-19(14-15)26-22(27)12-13-32-21/h2-11,14H,12-13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | QYLDWLMJVXQJBM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|