C20H20N4O4 — CID 2670407
3-ethyl-N'-[2-(2-methylphenoxy)acetyl]-4-oxophthalazine-1-carbohydrazide (PubChem CID 2670407) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-ethyl-N'-[2-(2-methylphenoxy)acetyl]-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-ethyl-N'-[2-(2-methylphenoxy)acetyl]-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 2670407 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-ethyl-N'-[2-(2-methylphenoxy)acetyl]-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)COc2ccccc2C)c2ccccc2c1=O |
| InChI | InChI=1S/C20H20N4O4/c1-3-24-20(27)15-10-6-5-9-14(15)18(23-24)19(26)22-21-17(25)12-28-16-11-7-4-8-13(16)2/h4-11H,3,12H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | AWZLCYZBVWXNTG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|