About methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate
methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 26705237) has the molecular formula C19H17Cl2NO3
and a molecular weight of 378.26 g/mol. Its IUPAC name is methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate |
| PubChem CID | 26705237 |
| Molecular Formula | C19H17Cl2NO3 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2NO3/c1-25-19(24)17(12-13-5-3-2-4-6-13)22-18(23)10-8-14-7-9-15(20)16(21)11-14/h2-11,17H,12H2,1H3,(H,22,23)/b10-8+/t17-/m0/s1 |
| InChIKey | DCQQTQXAUPOOLH-VMSUTVGLSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate?
The IUPAC name of methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate (CID 26705237) is methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate.
What is the SMILES notation for methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate?
The canonical SMILES for methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate is COC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate?
The InChIKey is DCQQTQXAUPOOLH-VMSUTVGLSA-N. The full InChI is InChI=1S/C19H17Cl2NO3/c1-25-19(24)17(12-13-5-3-2-4-6-13)22-18(23)10-8-14-7-9-15(20)16(21)11-14/h2-11,17H,12H2,1H3,(H,22,23)/b10-8+/t17-/m0/s1.
What are the key properties of methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate?
methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate has a molecular weight of 378.26 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-3-phenylpropanoate is sourced from PubChem (CID 26705237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).