C18H17BrN2O3 — CID 26706709
2-bromo-5-methoxy-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide (PubChem CID 26706709) has the molecular formula C18H17BrN2O3 and a molecular weight of 389.25 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-bromo-5-methoxy-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26706709 |
| Molecular Formula | C18H17BrN2O3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2-bromo-5-methoxy-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C18H17BrN2O3/c1-3-10-20-17(22)13-6-4-5-7-16(13)21-18(23)14-11-12(24-2)8-9-15(14)19/h3-9,11H,1,10H2,2H3,(H,20,22)(H,21,23) |
| InChIKey | RIIGNSFDRVBOSI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|