About 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide
4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide (PubChem CID 26708054) has the molecular formula C16H17BrClNO3S
and a molecular weight of 418.74 g/mol. Its IUPAC name is 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide |
| PubChem CID | 26708054 |
| Molecular Formula | C16H17BrClNO3S |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C16H17BrClNO3S/c1-4-19(9-11-5-6-14(18)23-11)16(20)10-7-12(21-2)15(17)13(8-10)22-3/h5-8H,4,9H2,1-3H3 |
| InChIKey | JHNYNHXFFAJBEB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide?
The IUPAC name of 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide (CID 26708054) is 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide.
What is the SMILES notation for 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide?
The canonical SMILES for 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide is CCN(Cc1ccc(Cl)s1)C(=O)c1cc(OC)c(Br)c(OC)c1.
What is the InChIKey of 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide?
The InChIKey is JHNYNHXFFAJBEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrClNO3S/c1-4-19(9-11-5-6-14(18)23-11)16(20)10-7-12(21-2)15(17)13(8-10)22-3/h5-8H,4,9H2,1-3H3.
What are the key properties of 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide?
4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide has a molecular weight of 418.74 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-3,5-dimethoxybenzamide is sourced from PubChem (CID 26708054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).