C16H11Cl3N4OS — CID 26720800
4-methyl-2-pyridin-2-yl-N'-(2,4,6-trichlorophenyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 26720800) has the molecular formula C16H11Cl3N4OS and a molecular weight of 413.72 g/mol. Its IUPAC name is 4-methyl-2-pyridin-2-yl-N'-(2,4,6-trichlorophenyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-pyridin-2-yl-N'-(2,4,6-trichlorophenyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26720800 |
| Molecular Formula | C16H11Cl3N4OS |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 4-methyl-2-pyridin-2-yl-N'-(2,4,6-trichlorophenyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccn2)sc1C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl3N4OS/c1-8-14(25-16(21-8)12-4-2-3-5-20-12)15(24)23-22-13-10(18)6-9(17)7-11(13)19/h2-7,22H,1H3,(H,23,24) |
| InChIKey | LYKIWVNDKMNBTN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|