C19H13ClN4O4 — CID 26721007
4-chloro-N'-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]benzohydrazide (PubChem CID 26721007) has the molecular formula C19H13ClN4O4 and a molecular weight of 396.79 g/mol. Its IUPAC name is 4-chloro-N'-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26721007 |
| Molecular Formula | C19H13ClN4O4 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-chloro-N'-[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cn1cnc2c(oc3ccccc32)c1=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClN4O4/c20-12-7-5-11(6-8-12)18(26)23-22-15(25)9-24-10-21-16-13-3-1-2-4-14(13)28-17(16)19(24)27/h1-8,10H,9H2,(H,22,25)(H,23,26) |
| InChIKey | ZVCLFBLATDLMGO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|