C12H6Cl2F2N2O — CID 26722050
2,6-dichloro-N-(2,4-difluorophenyl)pyridine-4-carboxamide (PubChem CID 26722050) has the molecular formula C12H6Cl2F2N2O and a molecular weight of 303.10 g/mol. Its IUPAC name is 2,6-dichloro-N-(2,4-difluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(2,4-difluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 26722050 |
| Molecular Formula | C12H6Cl2F2N2O |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2,6-dichloro-N-(2,4-difluorophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H6Cl2F2N2O/c13-10-3-6(4-11(14)18-10)12(19)17-9-2-1-7(15)5-8(9)16/h1-5H,(H,17,19) |
| InChIKey | OKHHZGOMQWCUQV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|