About 1-(methoxymethyl)-1,2,4-triazol-3-amine
1-(methoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 26722484) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-(methoxymethyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-(methoxymethyl)-1,2,4-triazol-3-amine |
| PubChem CID | 26722484 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 1-(methoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | COCn1cnc(N)n1 |
| InChI | InChI=1S/C4H8N4O/c1-9-3-8-2-6-4(5)7-8/h2H,3H2,1H3,(H2,5,7) |
| InChIKey | DEVALVYCKJZHRY-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(methoxymethyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxymethyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-(methoxymethyl)-1,2,4-triazol-3-amine (CID 26722484) is 1-(methoxymethyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-(methoxymethyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-(methoxymethyl)-1,2,4-triazol-3-amine is COCn1cnc(N)n1.
What is the InChIKey of 1-(methoxymethyl)-1,2,4-triazol-3-amine?
The InChIKey is DEVALVYCKJZHRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O/c1-9-3-8-2-6-4(5)7-8/h2H,3H2,1H3,(H2,5,7).
What are the key properties of 1-(methoxymethyl)-1,2,4-triazol-3-amine?
1-(methoxymethyl)-1,2,4-triazol-3-amine has a molecular weight of 128.13 g/mol, XLogP of -0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 26722484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).