C7H9NO2 — CID 26722643
2-(1-methylpyrrol-3-yl)acetic acid (PubChem CID 26722643) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 2-(1-methylpyrrol-3-yl)acetic acid.
| Compound Name | 2-(1-methylpyrrol-3-yl)acetic acid |
|---|---|
| PubChem CID | 26722643 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 2-(1-methylpyrrol-3-yl)acetic acid |
| SMILES | Cn1ccc(CC(=O)O)c1 |
| InChI | InChI=1S/C7H9NO2/c1-8-3-2-6(5-8)4-7(9)10/h2-3,5H,4H2,1H3,(H,9,10) |
| InChIKey | RDYCFHGCGWNFNU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |