C17H19ClNO4P — CID 26722672
4-[(R)-(4-chloroanilino)-[(2R,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol (PubChem CID 26722672) has the molecular formula C17H19ClNO4P and a molecular weight of 367.77 g/mol. Its IUPAC name is 4-[(R)-(4-chloroanilino)-[(2R,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol.
| Compound Name | 4-[(R)-(4-chloroanilino)-[(2R,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 26722672 |
| Molecular Formula | C17H19ClNO4P |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-[(R)-(4-chloroanilino)-[(2R,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol |
| SMILES | C[C@@H]1CCO[P@](=O)([C@@H](Nc2ccc(Cl)cc2)c2ccc(O)cc2)O1 |
| InChI | InChI=1S/C17H19ClNO4P/c1-12-10-11-22-24(21,23-12)17(13-2-8-16(20)9-3-13)19-15-6-4-14(18)5-7-15/h2-9,12,17,19-20H,10-11H2,1H3/t12-,17-,24-/m1/s1 |
| InChIKey | HYYAJLCSNVTTHM-GPCNDRGHSA-N |
| XLogP | 5.17 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|