C18H12Cl2N2O — CID 26727633
3,6-dichloro-N-(2-phenylphenyl)pyridine-2-carboxamide (PubChem CID 26727633) has the molecular formula C18H12Cl2N2O and a molecular weight of 343.21 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-phenylphenyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(2-phenylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26727633 |
| Molecular Formula | C18H12Cl2N2O |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 3,6-dichloro-N-(2-phenylphenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H12Cl2N2O/c19-14-10-11-16(20)22-17(14)18(23)21-15-9-5-4-8-13(15)12-6-2-1-3-7-12/h1-11H,(H,21,23) |
| InChIKey | DIJJIHJAQVLSHY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|