C14H9Cl2N5O — CID 26729277
2,3-dichloro-N-[4-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 26729277) has the molecular formula C14H9Cl2N5O and a molecular weight of 334.17 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 2,3-dichloro-N-[4-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 26729277 |
| Molecular Formula | C14H9Cl2N5O |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2,3-dichloro-N-[4-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-n2cnnn2)cc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H9Cl2N5O/c15-12-3-1-2-11(13(12)16)14(22)18-9-4-6-10(7-5-9)21-8-17-19-20-21/h1-8H,(H,18,22) |
| InChIKey | KAKRBNZNIZQGJC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |