C17H12F4N2O4 — CID 26739192
N'-(2,5-dimethylfuran-3-carbonyl)-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carbohydrazide (PubChem CID 26739192) has the molecular formula C17H12F4N2O4 and a molecular weight of 384.29 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carbohydrazide |
|---|---|
| PubChem CID | 26739192 |
| Molecular Formula | C17H12F4N2O4 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2c(C)oc3c(F)c(F)c(F)c(F)c23)c(C)o1 |
| InChI | InChI=1S/C17H12F4N2O4/c1-5-4-8(6(2)26-5)16(24)22-23-17(25)9-7(3)27-15-10(9)11(18)12(19)13(20)14(15)21/h4H,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | CGUASJIMFMYZER-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|