C24H28F3N3O6 — CID 26742202
(3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[4-(trifluoromethoxy)phenyl]azepane-1-carboxamide (PubChem CID 26742202) has the molecular formula C24H28F3N3O6 and a molecular weight of 511.50 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[4-(trifluoromethoxy)phenyl]azepane-1-carboxamide.
| Compound Name | (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[4-(trifluoromethoxy)phenyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 26742202 |
| Molecular Formula | C24H28F3N3O6 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[4-(trifluoromethoxy)phenyl]azepane-1-carboxamide |
| SMILES | COCCOc1ccc(C(=O)N[C@@H]2CN(C(=O)Nc3ccc(OC(F)(F)F)cc3)CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C24H28F3N3O6/c1-34-13-14-35-18-8-4-16(5-9-18)22(32)29-20-15-30(12-2-3-21(20)31)23(33)28-17-6-10-19(11-7-17)36-24(25,26)27/h4-11,20-21,31H,2-3,12-15H2,1H3,(H,28,33)(H,29,32)/t20-,21-/m1/s1 |
| InChIKey | HZBHKOWRTYVIMB-NHCUHLMSSA-N |
| XLogP | 3.40 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|