C24H28F3N3O5 — CID 26742203
(3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[3-(trifluoromethyl)phenyl]azepane-1-carboxamide (PubChem CID 26742203) has the molecular formula C24H28F3N3O5 and a molecular weight of 495.50 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[3-(trifluoromethyl)phenyl]azepane-1-carboxamide.
| Compound Name | (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[3-(trifluoromethyl)phenyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 26742203 |
| Molecular Formula | C24H28F3N3O5 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]-N-[3-(trifluoromethyl)phenyl]azepane-1-carboxamide |
| SMILES | COCCOc1ccc(C(=O)N[C@@H]2CN(C(=O)Nc3cccc(C(F)(F)F)c3)CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C24H28F3N3O5/c1-34-12-13-35-19-9-7-16(8-10-19)22(32)29-20-15-30(11-3-6-21(20)31)23(33)28-18-5-2-4-17(14-18)24(25,26)27/h2,4-5,7-10,14,20-21,31H,3,6,11-13,15H2,1H3,(H,28,33)(H,29,32)/t20-,21-/m1/s1 |
| InChIKey | QQELXAIQIBMXEG-NHCUHLMSSA-N |
| XLogP | 3.52 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|