About N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide
N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide (PubChem CID 26742207) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide |
| PubChem CID | 26742207 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)N[C@@H]2CNCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C16H24N2O4/c1-21-9-10-22-13-6-4-12(5-7-13)16(20)18-14-11-17-8-2-3-15(14)19/h4-7,14-15,17,19H,2-3,8-11H2,1H3,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | BXECYFNJUFEHAP-HUUCEWRRSA-N |
| XLogP | 0.55 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide?
The IUPAC name of N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide (CID 26742207) is N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide.
What is the SMILES notation for N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide?
The canonical SMILES for N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide is COCCOc1ccc(C(=O)N[C@@H]2CNCCC[C@H]2O)cc1.
What is the InChIKey of N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide?
The InChIKey is BXECYFNJUFEHAP-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H24N2O4/c1-21-9-10-22-13-6-4-12(5-7-13)16(20)18-14-11-17-8-2-3-15(14)19/h4-7,14-15,17,19H,2-3,8-11H2,1H3,(H,18,20)/t14-,15-/m1/s1.
What are the key properties of N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide?
N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide has a molecular weight of 308.38 g/mol, XLogP of 0.55, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-4-hydroxyazepan-3-yl]-4-(2-methoxyethoxy)benzamide is sourced from PubChem (CID 26742207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).