About 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone
2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone (PubChem CID 26742995) has the molecular formula C20H33N3O2
and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone.
Molecular Properties
| Compound Name | 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone |
| PubChem CID | 26742995 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone |
| SMILES | CCCCc1cc(C[C@H]2CNCC[C@H]2CC(=O)N2CCCCC2)no1 |
| InChI | InChI=1S/C20H33N3O2/c1-2-3-7-19-14-18(22-25-19)12-17-15-21-9-8-16(17)13-20(24)23-10-5-4-6-11-23/h14,16-17,21H,2-13,15H2,1H3/t16-,17-/m0/s1 |
| InChIKey | WWQPIFQZIAUQGU-IRXDYDNUSA-N |
| XLogP | 3.19 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone?
The IUPAC name of 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone (CID 26742995) is 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone.
What is the SMILES notation for 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone?
The canonical SMILES for 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone is CCCCc1cc(C[C@H]2CNCC[C@H]2CC(=O)N2CCCCC2)no1.
What is the InChIKey of 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone?
The InChIKey is WWQPIFQZIAUQGU-IRXDYDNUSA-N. The full InChI is InChI=1S/C20H33N3O2/c1-2-3-7-19-14-18(22-25-19)12-17-15-21-9-8-16(17)13-20(24)23-10-5-4-6-11-23/h14,16-17,21H,2-13,15H2,1H3/t16-,17-/m0/s1.
What are the key properties of 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone?
2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone has a molecular weight of 347.50 g/mol, XLogP of 3.19, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3-[(5-butyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]-1-piperidin-1-ylethanone is sourced from PubChem (CID 26742995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).