C19H25N3O4S — CID 26743221
[(4R,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazin-3-yl]methanone (PubChem CID 26743221) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazin-3-yl]methanone.
| Compound Name | [(4R,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazin-3-yl]methanone |
|---|---|
| PubChem CID | 26743221 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [(4R,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(furan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazin-3-yl]methanone |
| SMILES | C[C@@H]1CCN(C(=O)C2=CC(c3ccco3)=NS(=O)(=O)N2C)[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C19H25N3O4S/c1-13-9-10-22(16-7-4-3-6-14(13)16)19(23)17-12-15(18-8-5-11-26-18)20-27(24,25)21(17)2/h5,8,11-14,16H,3-4,6-7,9-10H2,1-2H3/t13-,14+,16-/m1/s1 |
| InChIKey | RERZDHKTOIPMBG-IJEWVQPXSA-N |
| XLogP | 2.57 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |