C26H32N4O — CID 26743389
4-[[[(1S,4S)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline (PubChem CID 26743389) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-[[[(1S,4S)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[(1S,4S)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 26743389 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-[[[(1S,4S)-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-n2nc(C)c([C@@H]3C=C[C@@H](NCc4ccc(N(C)C)cc4)C3)c2C)cc1 |
| InChI | InChI=1S/C26H32N4O/c1-18-26(19(2)30(28-18)24-12-14-25(31-5)15-13-24)21-8-9-22(16-21)27-17-20-6-10-23(11-7-20)29(3)4/h6-15,21-22,27H,16-17H2,1-5H3/t21-,22-/m1/s1 |
| InChIKey | PSQJCJHBEDOKFE-FGZHOGPDSA-N |
| XLogP | 4.77 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|