C20H20FN3O2S2 — CID 26743408
N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-sulfonamide (PubChem CID 26743408) has the molecular formula C20H20FN3O2S2 and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26743408 |
| Molecular Formula | C20H20FN3O2S2 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-sulfonamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1[C@@H]1C=C[C@@H](NS(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C20H20FN3O2S2/c1-13-20(14(2)24(22-13)18-9-6-16(21)7-10-18)15-5-8-17(12-15)23-28(25,26)19-4-3-11-27-19/h3-11,15,17,23H,12H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | HVMVZINNZHCXQS-NVXWUHKLSA-N |
| XLogP | 4.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|