C19H17FN4O4 — CID 26744415
(3R,5S)-5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(2-nitrophenyl)methyl]pyrrolidin-3-ol (PubChem CID 26744415) has the molecular formula C19H17FN4O4 and a molecular weight of 384.37 g/mol. Its IUPAC name is (3R,5S)-5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(2-nitrophenyl)methyl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(2-nitrophenyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 26744415 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (3R,5S)-5-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-[(2-nitrophenyl)methyl]pyrrolidin-3-ol |
| SMILES | O=[N+]([O-])c1ccccc1CN1C[C@H](O)C[C@H]1c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C19H17FN4O4/c20-14-7-5-12(6-8-14)18-21-19(28-22-18)17-9-15(25)11-23(17)10-13-3-1-2-4-16(13)24(26)27/h1-8,15,17,25H,9-11H2/t15-,17+/m1/s1 |
| InChIKey | YRWHTCSTIPMBSZ-WBVHZDCISA-N |
| XLogP | 3.09 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|