C22H31N3O3S — CID 26744711
(3aS,4R,5R,7R,7aR)-N-cyclopentyl-4,5-dihydroxy-2-(4-propan-2-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 26744711) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-N-cyclopentyl-4,5-dihydroxy-2-(4-propan-2-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-N-cyclopentyl-4,5-dihydroxy-2-(4-propan-2-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 26744711 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-N-cyclopentyl-4,5-dihydroxy-2-(4-propan-2-ylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | CC(C)c1ccc(NC2=N[C@H]3[C@@H](O)[C@H](O)C[C@H](C(=O)NC4CCCC4)[C@H]3S2)cc1 |
| InChI | InChI=1S/C22H31N3O3S/c1-12(2)13-7-9-15(10-8-13)24-22-25-18-19(27)17(26)11-16(20(18)29-22)21(28)23-14-5-3-4-6-14/h7-10,12,14,16-20,26-27H,3-6,11H2,1-2H3,(H,23,28)(H,24,25)/t16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | DEDNCSPPOBJZFQ-LJDSDSDDSA-N |
| XLogP | 2.86 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |