C25H27NO2 — CID 26747
N-ethyl-N-(3-hydroxy-1,3,3-triphenylpropyl)acetamide (PubChem CID 26747) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-ethyl-N-(3-hydroxy-1,3,3-triphenylpropyl)acetamide.
| Compound Name | N-ethyl-N-(3-hydroxy-1,3,3-triphenylpropyl)acetamide |
|---|---|
| PubChem CID | 26747 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-ethyl-N-(3-hydroxy-1,3,3-triphenylpropyl)acetamide |
| SMILES | CCN(C(C)=O)C(CC(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NO2/c1-3-26(20(2)27)24(21-13-7-4-8-14-21)19-25(28,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24,28H,3,19H2,1-2H3 |
| InChIKey | IWVHEAPNZYLYDY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |