About Selegiline Hydrochloride
Selegiline Hydrochloride (PubChem CID 26758) has the molecular formula C13H18ClN
and a molecular weight of 223.74 g/mol. Its IUPAC name is (2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | Selegiline Hydrochloride |
| PubChem CID | 26758 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.74 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine;hydrochloride |
| SMILES | C[C@H](CC1=CC=CC=C1)N(C)CC#C.Cl |
| InChI | InChI=1S/C13H17N.ClH/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13;/h1,5-9,12H,10-11H2,2-3H3;1H/t12-;/m1./s1 |
| InChIKey | IYETZZCWLLUHIJ-UTONKHPSSA-N |
| XLogP | — |
| TPSA | 3.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 195 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze Selegiline Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Selegiline Hydrochloride?
The IUPAC name of Selegiline Hydrochloride (CID 26758) is (2R)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine;hydrochloride.
What is the SMILES notation for Selegiline Hydrochloride?
The canonical SMILES for Selegiline Hydrochloride is C[C@H](CC1=CC=CC=C1)N(C)CC#C.Cl.
What is the InChIKey of Selegiline Hydrochloride?
The InChIKey is IYETZZCWLLUHIJ-UTONKHPSSA-N. The full InChI is InChI=1S/C13H17N.ClH/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13;/h1,5-9,12H,10-11H2,2-3H3;1H/t12-;/m1./s1.
What are the key properties of Selegiline Hydrochloride?
Selegiline Hydrochloride has a molecular weight of 223.74 g/mol, XLogP of not available, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Selegiline Hydrochloride is sourced from PubChem (CID 26758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).