C22H24ClN5O2 — CID 26758335
[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 26758335) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 26758335 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C(=O)N2CCN(c3ncccn3)CC2)c1C |
| InChI | InChI=1S/C22H24ClN5O2/c1-15-13-18(16(2)28(15)19-14-17(23)5-6-20(19)30-3)21(29)26-9-11-27(12-10-26)22-24-7-4-8-25-22/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | HDKXXXRRXWBULY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|