C23H27ClN6O3 — CID 26762377
3-[(4R,7S,8aS)-7-[(3-chlorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 26762377) has the molecular formula C23H27ClN6O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-7-[(3-chlorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[(4R,7S,8aS)-7-[(3-chlorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 26762377 |
| Molecular Formula | C23H27ClN6O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3-[(4R,7S,8aS)-7-[(3-chlorophenyl)carbamoylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CC[C@@H]1CNC(=O)[C@@H]2C[C@H](NC(=O)Nc3cccc(Cl)c3)CN12)NCc1cccnc1 |
| InChI | InChI=1S/C23H27ClN6O3/c24-16-4-1-5-17(9-16)28-23(33)29-18-10-20-22(32)27-13-19(30(20)14-18)6-7-21(31)26-12-15-3-2-8-25-11-15/h1-5,8-9,11,18-20H,6-7,10,12-14H2,(H,26,31)(H,27,32)(H2,28,29,33)/t18-,19+,20-/m0/s1 |
| InChIKey | RIFSAWLYFWEAMH-ZCNNSNEGSA-N |
| XLogP | 1.89 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |