C18H31N5O4 — CID 26762675
1-[(4R,7S,8aS)-4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-propan-2-ylurea (PubChem CID 26762675) has the molecular formula C18H31N5O4 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[(4R,7S,8aS)-4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(4R,7S,8aS)-4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 26762675 |
| Molecular Formula | C18H31N5O4 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 1-[(4R,7S,8aS)-4-(3-morpholin-4-yl-3-oxopropyl)-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N[C@H]1C[C@H]2C(=O)NC[C@@H](CCC(=O)N3CCOCC3)N2C1 |
| InChI | InChI=1S/C18H31N5O4/c1-12(2)20-18(26)21-13-9-15-17(25)19-10-14(23(15)11-13)3-4-16(24)22-5-7-27-8-6-22/h12-15H,3-11H2,1-2H3,(H,19,25)(H2,20,21,26)/t13-,14+,15-/m0/s1 |
| InChIKey | UWBNBSNLSUTSAR-ZNMIVQPWSA-N |
| XLogP | -0.73 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |