C17H29N5O3 — CID 26762754
3-[(4R,7S,8aS)-1-oxo-7-(propan-2-ylcarbamoylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-cyclopropylpropanamide (PubChem CID 26762754) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-[(4R,7S,8aS)-1-oxo-7-(propan-2-ylcarbamoylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-cyclopropylpropanamide.
| Compound Name | 3-[(4R,7S,8aS)-1-oxo-7-(propan-2-ylcarbamoylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 26762754 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 3-[(4R,7S,8aS)-1-oxo-7-(propan-2-ylcarbamoylamino)-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N-cyclopropylpropanamide |
| SMILES | CC(C)NC(=O)N[C@H]1C[C@H]2C(=O)NC[C@@H](CCC(=O)NC3CC3)N2C1 |
| InChI | InChI=1S/C17H29N5O3/c1-10(2)19-17(25)21-12-7-14-16(24)18-8-13(22(14)9-12)5-6-15(23)20-11-3-4-11/h10-14H,3-9H2,1-2H3,(H,18,24)(H,20,23)(H2,19,21,25)/t12-,13+,14-/m0/s1 |
| InChIKey | QFSKNRKLJMPVKW-MJBXVCDLSA-N |
| XLogP | -0.31 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |