C24H27N3O8 — CID 26763414
[(3S,3aR,6R,6aS)-3-[(3,5-dimethoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate (PubChem CID 26763414) has the molecular formula C24H27N3O8 and a molecular weight of 485.49 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-[(3,5-dimethoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-[(3,5-dimethoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 26763414 |
| Molecular Formula | C24H27N3O8 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-[(3,5-dimethoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate |
| SMILES | COc1cc(NC(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3OC(=O)Nc2cccc(C(C)=O)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H27N3O8/c1-13(28)14-5-4-6-15(7-14)26-24(30)35-20-12-34-21-19(11-33-22(20)21)27-23(29)25-16-8-17(31-2)10-18(9-16)32-3/h4-10,19-22H,11-12H2,1-3H3,(H,26,30)(H2,25,27,29)/t19-,20+,21+,22+/m0/s1 |
| InChIKey | YZJCCXSXJKRYGE-DXBBTUNJSA-N |
| XLogP | 2.81 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |