About N-(4-ethylphenyl)-2,2,2-trifluoroacetamide
N-(4-ethylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 26767) has the molecular formula C10H10F3NO
and a molecular weight of 217.19 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(4-ethylphenyl)-2,2,2-trifluoroacetamide |
| PubChem CID | 26767 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-(4-ethylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | CCc1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO/c1-2-7-3-5-8(6-4-7)14-9(15)10(11,12)13/h3-6H,2H2,1H3,(H,14,15) |
| InChIKey | VEYAGSUQCDESMW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-ethylphenyl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethylphenyl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(4-ethylphenyl)-2,2,2-trifluoroacetamide (CID 26767) is N-(4-ethylphenyl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(4-ethylphenyl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(4-ethylphenyl)-2,2,2-trifluoroacetamide is CCc1ccc(NC(=O)C(F)(F)F)cc1.
What is the InChIKey of N-(4-ethylphenyl)-2,2,2-trifluoroacetamide?
The InChIKey is VEYAGSUQCDESMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO/c1-2-7-3-5-8(6-4-7)14-9(15)10(11,12)13/h3-6H,2H2,1H3,(H,14,15).
What are the key properties of N-(4-ethylphenyl)-2,2,2-trifluoroacetamide?
N-(4-ethylphenyl)-2,2,2-trifluoroacetamide has a molecular weight of 217.19 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethylphenyl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 26767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).