C15H13FINO — CID 2676752
2-(2-fluorophenyl)-N-(3-iodo-4-methylphenyl)acetamide (PubChem CID 2676752) has the molecular formula C15H13FINO and a molecular weight of 369.18 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-(3-iodo-4-methylphenyl)acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-(3-iodo-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2676752 |
| Molecular Formula | C15H13FINO |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2-(2-fluorophenyl)-N-(3-iodo-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccccc2F)cc1I |
| InChI | InChI=1S/C15H13FINO/c1-10-6-7-12(9-14(10)17)18-15(19)8-11-4-2-3-5-13(11)16/h2-7,9H,8H2,1H3,(H,18,19) |
| InChIKey | CHUFGOFTBKFUKO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|